C10H8N2O — CID 19781538
3-methyl-1,4-benzodiazepin-2-one (PubChem CID 19781538) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 3-methyl-1,4-benzodiazepin-2-one.
| Compound Name | 3-methyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 19781538 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3-methyl-1,4-benzodiazepin-2-one |
| SMILES | Cc1ncc2ccccc2nc1=O |
| InChI | InChI=1S/C10H8N2O/c1-7-10(13)12-9-5-3-2-4-8(9)6-11-7/h2-6H,1H3 |
| InChIKey | ZXULLMNFMIZZCF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |