C14H16O2 — CID 19805748
4-(2-phenylethyl)cyclohexa-1,5-diene-1,4-diol (PubChem CID 19805748) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-(2-phenylethyl)cyclohexa-1,5-diene-1,4-diol.
| Compound Name | 4-(2-phenylethyl)cyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 19805748 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4-(2-phenylethyl)cyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=CCC(O)(CCc2ccccc2)C=C1 |
| InChI | InChI=1S/C14H16O2/c15-13-7-10-14(16,11-8-13)9-6-12-4-2-1-3-5-12/h1-5,7-8,10,15-16H,6,9,11H2 |
| InChIKey | MYSJYUUKFIVTQZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |