About CID 19820299
CID 19820299 (PubChem CID 19820299) has the molecular formula C12H27O2Si
and a molecular weight of 231.43 g/mol.
Molecular Properties
| Compound Name | CID 19820299 |
| PubChem CID | 19820299 |
| Molecular Formula | C12H27O2Si |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)C[Si](C)C(OC)OC |
| InChI | InChI=1S/C12H27O2Si/c1-6-8-9-11(7-2)10-15(5)12(13-3)14-4/h11-12H,6-10H2,1-5H3 |
| InChIKey | FDLWUSQABRBDCS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 19820299 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19820299?
The IUPAC name of CID 19820299 (CID 19820299) is not available.
What is the SMILES notation for CID 19820299?
The canonical SMILES for CID 19820299 is CCCCC(CC)C[Si](C)C(OC)OC.
What is the InChIKey of CID 19820299?
The InChIKey is FDLWUSQABRBDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27O2Si/c1-6-8-9-11(7-2)10-15(5)12(13-3)14-4/h11-12H,6-10H2,1-5H3.
What are the key properties of CID 19820299?
CID 19820299 has a molecular weight of 231.43 g/mol, XLogP of 3.49, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19820299 is sourced from PubChem (CID 19820299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).