C15H15F2N — CID 19840872
4-[3-(2,2-difluoroethenyl)cyclohexyl]benzonitrile (PubChem CID 19840872) has the molecular formula C15H15F2N and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-[3-(2,2-difluoroethenyl)cyclohexyl]benzonitrile.
| Compound Name | 4-[3-(2,2-difluoroethenyl)cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19840872 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-[3-(2,2-difluoroethenyl)cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCCC(C=C(F)F)C2)cc1 |
| InChI | InChI=1S/C15H15F2N/c16-15(17)9-12-2-1-3-14(8-12)13-6-4-11(10-18)5-7-13/h4-7,9,12,14H,1-3,8H2 |
| InChIKey | STLZTIDMOBSXMG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |