C21H27N5O6 — CID 19850123
[4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl 2-amino-2-phenylacetate (PubChem CID 19850123) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is [4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl 2-amino-2-phenylacetate.
| Compound Name | [4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl 2-amino-2-phenylacetate |
|---|---|
| PubChem CID | 19850123 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [4-[3-(3,5-dioxopiperazin-1-yl)butan-2-yl]-2,6-dioxopiperazin-1-yl]methyl 2-amino-2-phenylacetate |
| SMILES | CC(C(C)N1CC(=O)N(COC(=O)C(N)c2ccccc2)C(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C21H27N5O6/c1-13(24-8-16(27)23-17(28)9-24)14(2)25-10-18(29)26(19(30)11-25)12-32-21(31)20(22)15-6-4-3-5-7-15/h3-7,13-14,20H,8-12,22H2,1-2H3,(H,23,27,28) |
| InChIKey | UJQAUAVXCOYPSF-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|