C15H14F5NO3 — CID 19857919
methyl 3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 19857919) has the molecular formula C15H14F5NO3 and a molecular weight of 351.27 g/mol. Its IUPAC name is methyl 3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | methyl 3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 19857919 |
| Molecular Formula | C15H14F5NO3 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | methyl 3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COC(=O)N1C2CCC1CC(Oc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C15H14F5NO3/c1-23-15(22)21-6-2-3-7(21)5-8(4-6)24-14-12(19)10(17)9(16)11(18)13(14)20/h6-8H,2-5H2,1H3 |
| InChIKey | KKGASECNARZKPP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|