C17H30N2O5 — CID 19869425
N',N'-diethyl-N-(3-phenylpropyl)ethane-1,2-diamine;oxalic acid;hydrate (PubChem CID 19869425) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is N',N'-diethyl-N-(3-phenylpropyl)ethane-1,2-diamine;oxalic acid;hydrate.
| Compound Name | N',N'-diethyl-N-(3-phenylpropyl)ethane-1,2-diamine;oxalic acid;hydrate |
|---|---|
| PubChem CID | 19869425 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | N',N'-diethyl-N-(3-phenylpropyl)ethane-1,2-diamine;oxalic acid;hydrate |
| SMILES | CCN(CC)CCNCCCc1ccccc1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H26N2.C2H2O4.H2O/c1-3-17(4-2)14-13-16-12-8-11-15-9-6-5-7-10-15;3-1(4)2(5)6;/h5-7,9-10,16H,3-4,8,11-14H2,1-2H3;(H,3,4)(H,5,6);1H2 |
| InChIKey | BKOHZLKBIZHMOL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|