About tetrapropylazanium thiocyanate
tetrapropylazanium thiocyanate (PubChem CID 19875508) has the molecular formula C13H28N2S
and a molecular weight of 244.45 g/mol. Its IUPAC name is tetrapropylazanium thiocyanate.
Molecular Properties
| Compound Name | tetrapropylazanium thiocyanate |
| PubChem CID | 19875508 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | tetrapropylazanium thiocyanate |
| SMILES | CCC[N+](CCC)(CCC)CCC.N#C[S-] |
| InChI | InChI=1S/C12H28N.CHNS/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1-3/h5-12H2,1-4H3;3H/q+1;/p-1 |
| InChIKey | QWQCHNPMGYGPQE-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze tetrapropylazanium thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropylazanium thiocyanate?
The IUPAC name of tetrapropylazanium thiocyanate (CID 19875508) is tetrapropylazanium thiocyanate.
What is the SMILES notation for tetrapropylazanium thiocyanate?
The canonical SMILES for tetrapropylazanium thiocyanate is CCC[N+](CCC)(CCC)CCC.N#C[S-].
What is the InChIKey of tetrapropylazanium thiocyanate?
The InChIKey is QWQCHNPMGYGPQE-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.CHNS/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1-3/h5-12H2,1-4H3;3H/q+1;/p-1.
What are the key properties of tetrapropylazanium thiocyanate?
tetrapropylazanium thiocyanate has a molecular weight of 244.45 g/mol, XLogP of 3.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropylazanium thiocyanate is sourced from PubChem (CID 19875508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).