C19H26O3S — CID 19883105
propan-2-yl 2,3-di(propan-2-yl)naphthalene-1-sulfonate (PubChem CID 19883105) has the molecular formula C19H26O3S and a molecular weight of 334.48 g/mol. Its IUPAC name is propan-2-yl 2,3-di(propan-2-yl)naphthalene-1-sulfonate.
| Compound Name | propan-2-yl 2,3-di(propan-2-yl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 19883105 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | propan-2-yl 2,3-di(propan-2-yl)naphthalene-1-sulfonate |
| SMILES | CC(C)OS(=O)(=O)c1c(C(C)C)c(C(C)C)cc2ccccc12 |
| InChI | InChI=1S/C19H26O3S/c1-12(2)17-11-15-9-7-8-10-16(15)19(18(17)13(3)4)23(20,21)22-14(5)6/h7-14H,1-6H3 |
| InChIKey | PESFGTVXDWZXHG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|