C24H38O3S — CID 19983009
(2,2,6,6-tetramethylthian-4-yl) 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 19983009) has the molecular formula C24H38O3S and a molecular weight of 406.63 g/mol. Its IUPAC name is (2,2,6,6-tetramethylthian-4-yl) 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | (2,2,6,6-tetramethylthian-4-yl) 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 19983009 |
| Molecular Formula | C24H38O3S |
| Molecular Weight | 406.63 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (2,2,6,6-tetramethylthian-4-yl) 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CC1(C)CC(OC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC(C)(C)S1 |
| InChI | InChI=1S/C24H38O3S/c1-21(2,3)17-11-15(12-18(19(17)25)22(4,5)6)20(26)27-16-13-23(7,8)28-24(9,10)14-16/h11-12,16,25H,13-14H2,1-10H3 |
| InChIKey | JFWHHEALCFLHAO-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |