About 2-bromotriphenylene
2-bromotriphenylene (PubChem CID 18381174) has the molecular formula C18H11Br
and a molecular weight of 307.19 g/mol. Its IUPAC name is 2-bromotriphenylene.
Molecular Properties
| Compound Name | 2-bromotriphenylene |
| PubChem CID | 18381174 |
| Molecular Formula | C18H11Br |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-bromotriphenylene |
| SMILES | Brc1ccc2c3ccccc3c3ccccc3c2c1 |
| InChI | InChI=1S/C18H11Br/c19-12-9-10-17-15-7-2-1-5-13(15)14-6-3-4-8-16(14)18(17)11-12/h1-11H |
| InChIKey | GEDOYYDMCZUHNW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-bromotriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromotriphenylene?
The IUPAC name of 2-bromotriphenylene (CID 18381174) is 2-bromotriphenylene.
What is the SMILES notation for 2-bromotriphenylene?
The canonical SMILES for 2-bromotriphenylene is Brc1ccc2c3ccccc3c3ccccc3c2c1.
What is the InChIKey of 2-bromotriphenylene?
The InChIKey is GEDOYYDMCZUHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Br/c19-12-9-10-17-15-7-2-1-5-13(15)14-6-3-4-8-16(14)18(17)11-12/h1-11H.
What are the key properties of 2-bromotriphenylene?
2-bromotriphenylene has a molecular weight of 307.19 g/mol, XLogP of 5.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromotriphenylene is sourced from PubChem (CID 18381174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).