About 2-iminohexanediamide
2-iminohexanediamide (PubChem CID 175736395) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-iminohexanediamide.
Molecular Properties
| Compound Name | 2-iminohexanediamide |
| PubChem CID | 175736395 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-iminohexanediamide |
| SMILES | [H]/N=C(\CCCC(N)=O)C(N)=O |
| InChI | InChI=1S/C6H11N3O2/c7-4(6(9)11)2-1-3-5(8)10/h7H,1-3H2,(H2,8,10)(H2,9,11)/b7-4+ |
| InChIKey | QOTSUMAZFHGAOO-QPJJXVBHSA-N |
| XLogP | -0.85 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminohexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminohexanediamide?
The IUPAC name of 2-iminohexanediamide (CID 175736395) is 2-iminohexanediamide.
What is the SMILES notation for 2-iminohexanediamide?
The canonical SMILES for 2-iminohexanediamide is [H]/N=C(\CCCC(N)=O)C(N)=O.
What is the InChIKey of 2-iminohexanediamide?
The InChIKey is QOTSUMAZFHGAOO-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H11N3O2/c7-4(6(9)11)2-1-3-5(8)10/h7H,1-3H2,(H2,8,10)(H2,9,11)/b7-4+.
What are the key properties of 2-iminohexanediamide?
2-iminohexanediamide has a molecular weight of 157.17 g/mol, XLogP of -0.85, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminohexanediamide is sourced from PubChem (CID 175736395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).