C29H54N2O4 — CID 20512124
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis(2-methylpropyl)propanedioate (PubChem CID 20512124) has the molecular formula C29H54N2O4 and a molecular weight of 494.76 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis(2-methylpropyl)propanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis(2-methylpropyl)propanedioate |
|---|---|
| PubChem CID | 20512124 |
| Molecular Formula | C29H54N2O4 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis(2-methylpropyl)propanedioate |
| SMILES | CC(C)CC(CC(C)C)(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C29H54N2O4/c1-19(2)13-29(14-20(3)4,23(32)34-21-15-25(5,6)30-26(7,8)16-21)24(33)35-22-17-27(9,10)31-28(11,12)18-22/h19-22,30-31H,13-18H2,1-12H3 |
| InChIKey | TVCJSJVBLVKRGN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|