About 1-ethyl-5H-pteridine
1-ethyl-5H-pteridine (PubChem CID 20535714) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 1-ethyl-5H-pteridine.
Molecular Properties
| Compound Name | 1-ethyl-5H-pteridine |
| PubChem CID | 20535714 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-ethyl-5H-pteridine |
| SMILES | CCN1C=NC=C2NC=CN=C21 |
| InChI | InChI=1S/C8H10N4/c1-2-12-6-9-5-7-8(12)11-4-3-10-7/h3-6,10H,2H2,1H3 |
| InChIKey | IXVOMXJPLSARLW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-5H-pteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5H-pteridine?
The IUPAC name of 1-ethyl-5H-pteridine (CID 20535714) is 1-ethyl-5H-pteridine.
What is the SMILES notation for 1-ethyl-5H-pteridine?
The canonical SMILES for 1-ethyl-5H-pteridine is CCN1C=NC=C2NC=CN=C21.
What is the InChIKey of 1-ethyl-5H-pteridine?
The InChIKey is IXVOMXJPLSARLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-2-12-6-9-5-7-8(12)11-4-3-10-7/h3-6,10H,2H2,1H3.
What are the key properties of 1-ethyl-5H-pteridine?
1-ethyl-5H-pteridine has a molecular weight of 162.20 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5H-pteridine is sourced from PubChem (CID 20535714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).