C7H11N3 — CID 171531972
N,N-dimethyl-2-methylidene-1H-pyrazin-3-amine (PubChem CID 171531972) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is N,N-dimethyl-2-methylidene-1H-pyrazin-3-amine.
| Compound Name | N,N-dimethyl-2-methylidene-1H-pyrazin-3-amine |
|---|---|
| PubChem CID | 171531972 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | N,N-dimethyl-2-methylidene-1H-pyrazin-3-amine |
| SMILES | C=C1NC=CN=C1N(C)C |
| InChI | InChI=1S/C7H11N3/c1-6-7(10(2)3)9-5-4-8-6/h4-5,8H,1H2,2-3H3 |
| InChIKey | VHFKYORDRRZJGX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |