C32H42IO11+ — CID 20582153
[4-[2-[2-hydroxy-3-[3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propoxy]propoxy]-2-oxoethoxy]phenyl]-(4-methylphenyl)iodanium (PubChem CID 20582153) has the molecular formula C32H42IO11+ and a molecular weight of 729.58 g/mol. Its IUPAC name is [4-[2-[2-hydroxy-3-[3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propoxy]propoxy]-2-oxoethoxy]phenyl]-(4-methylphenyl)iodanium.
| Compound Name | [4-[2-[2-hydroxy-3-[3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propoxy]propoxy]-2-oxoethoxy]phenyl]-(4-methylphenyl)iodanium |
|---|---|
| PubChem CID | 20582153 |
| Molecular Formula | C32H42IO11+ |
| Molecular Weight | 729.58 g/mol |
| Exact Mass | 729.18 |
| IUPAC Name | [4-[2-[2-hydroxy-3-[3-(oxiran-2-ylmethoxy)-2,2-bis(oxiran-2-ylmethoxymethyl)propoxy]propoxy]-2-oxoethoxy]phenyl]-(4-methylphenyl)iodanium |
| SMILES | Cc1ccc([I+]c2ccc(OCC(=O)OCC(O)COCC(COCC3CO3)(COCC3CO3)COCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C32H42IO11/c1-23-2-4-24(5-3-23)33-25-6-8-27(9-7-25)43-18-31(35)44-11-26(34)10-36-19-32(20-37-12-28-15-40-28,21-38-13-29-16-41-29)22-39-14-30-17-42-30/h2-9,26,28-30,34H,10-22H2,1H3/q+1 |
| InChIKey | RYQSIFZQIWBCKZ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.58 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|