C9H10N4O4S — CID 20585548
6-(3-hydroperoxybut-3-enyl)-4-methyl-[1,2,5]thiadiazolo[3,4-d]pyrimidine-5,7-dione (PubChem CID 20585548) has the molecular formula C9H10N4O4S and a molecular weight of 270.27 g/mol. Its IUPAC name is 6-(3-hydroperoxybut-3-enyl)-4-methyl-[1,2,5]thiadiazolo[3,4-d]pyrimidine-5,7-dione.
| Compound Name | 6-(3-hydroperoxybut-3-enyl)-4-methyl-[1,2,5]thiadiazolo[3,4-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 20585548 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 6-(3-hydroperoxybut-3-enyl)-4-methyl-[1,2,5]thiadiazolo[3,4-d]pyrimidine-5,7-dione |
| SMILES | C=C(CCn1c(=O)c2nsnc2n(C)c1=O)OO |
| InChI | InChI=1S/C9H10N4O4S/c1-5(17-16)3-4-13-8(14)6-7(11-18-10-6)12(2)9(13)15/h16H,1,3-4H2,2H3 |
| InChIKey | TVLSFPZNPYYWQS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|