C13H18N4O5S — CID 20822795
3-hydroxypropyl 4-(2-amino-4-methyl-5,7-dioxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)butanoate (PubChem CID 20822795) has the molecular formula C13H18N4O5S and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-hydroxypropyl 4-(2-amino-4-methyl-5,7-dioxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)butanoate.
| Compound Name | 3-hydroxypropyl 4-(2-amino-4-methyl-5,7-dioxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)butanoate |
|---|---|
| PubChem CID | 20822795 |
| Molecular Formula | C13H18N4O5S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-hydroxypropyl 4-(2-amino-4-methyl-5,7-dioxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl)butanoate |
| SMILES | Cn1c(=O)n(CCCC(=O)OCCCO)c(=O)c2sc(N)nc21 |
| InChI | InChI=1S/C13H18N4O5S/c1-16-10-9(23-12(14)15-10)11(20)17(13(16)21)5-2-4-8(19)22-7-3-6-18/h18H,2-7H2,1H3,(H2,14,15) |
| InChIKey | IDNLMBJKBDTPQT-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|