C33H25NO5S — CID 20602004
2-[[2-[4-(6-phenacyloxynaphthalen-2-yl)sulfanylphenyl]acetyl]amino]benzoic acid (PubChem CID 20602004) has the molecular formula C33H25NO5S and a molecular weight of 547.63 g/mol. Its IUPAC name is 2-[[2-[4-(6-phenacyloxynaphthalen-2-yl)sulfanylphenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-(6-phenacyloxynaphthalen-2-yl)sulfanylphenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602004 |
| Molecular Formula | C33H25NO5S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-[[2-[4-(6-phenacyloxynaphthalen-2-yl)sulfanylphenyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(Sc2ccc3cc(OCC(=O)c4ccccc4)ccc3c2)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C33H25NO5S/c35-31(23-6-2-1-3-7-23)21-39-26-14-12-25-20-28(17-13-24(25)19-26)40-27-15-10-22(11-16-27)18-32(36)34-30-9-5-4-8-29(30)33(37)38/h1-17,19-20H,18,21H2,(H,34,36)(H,37,38) |
| InChIKey | PAXIFNJXHJGEGD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |