C25H20N2O4S — CID 174436321
2-[[2-[6-(4-phenylmethoxythiophen-2-yl)-3-pyridinyl]acetyl]amino]benzoic acid (PubChem CID 174436321) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-[[2-[6-(4-phenylmethoxythiophen-2-yl)-3-pyridinyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[6-(4-phenylmethoxythiophen-2-yl)-3-pyridinyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174436321 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[[2-[6-(4-phenylmethoxythiophen-2-yl)-3-pyridinyl]acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc(-c2cc(OCc3ccccc3)cs2)nc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C25H20N2O4S/c28-24(27-21-9-5-4-8-20(21)25(29)30)12-18-10-11-22(26-14-18)23-13-19(16-32-23)31-15-17-6-2-1-3-7-17/h1-11,13-14,16H,12,15H2,(H,27,28)(H,29,30) |
| InChIKey | BHYKPICOWZPECZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |