C22H23F9O4 — CID 20615214
[4-[5-(4-ethylcyclohexyl)-1,3-dioxan-2-yl]-2,6-difluorophenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 20615214) has the molecular formula C22H23F9O4 and a molecular weight of 522.40 g/mol. Its IUPAC name is [4-[5-(4-ethylcyclohexyl)-1,3-dioxan-2-yl]-2,6-difluorophenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[5-(4-ethylcyclohexyl)-1,3-dioxan-2-yl]-2,6-difluorophenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 20615214 |
| Molecular Formula | C22H23F9O4 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | [4-[5-(4-ethylcyclohexyl)-1,3-dioxan-2-yl]-2,6-difluorophenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCC1CCC(C2COC(c3cc(F)c(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C22H23F9O4/c1-2-11-3-5-12(6-4-11)14-9-33-18(34-10-14)13-7-15(23)17(16(24)8-13)35-19(32)20(25,26)21(27,28)22(29,30)31/h7-8,11-12,14,18H,2-6,9-10H2,1H3 |
| InChIKey | KVQOHVPXRKFURD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|