C25H36N2O12 — CID 20615559
[2-[[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]methylcarbamoyloxy]-4-hydroperoxy-5-methylhex-5-enyl] 2-methylprop-2-enoate (PubChem CID 20615559) has the molecular formula C25H36N2O12 and a molecular weight of 556.57 g/mol. Its IUPAC name is [2-[[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]methylcarbamoyloxy]-4-hydroperoxy-5-methylhex-5-enyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]methylcarbamoyloxy]-4-hydroperoxy-5-methylhex-5-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20615559 |
| Molecular Formula | C25H36N2O12 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | [2-[[1,3-bis(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]methylcarbamoyloxy]-4-hydroperoxy-5-methylhex-5-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)OC(=O)NCNC(=O)OC(COC(=O)C(=C)C)CC(OO)C(=C)C |
| InChI | InChI=1S/C25H36N2O12/c1-14(2)20(39-33)9-18(10-34-21(28)15(3)4)37-24(31)26-13-27-25(32)38-19(11-35-22(29)16(5)6)12-36-23(30)17(7)8/h18-20,33H,1,3,5,7,9-13H2,2,4,6,8H3,(H,26,31)(H,27,32) |
| InChIKey | NWZBOROCVVVTEA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|