C14H12BrN5O2 — CID 20616591
1-[4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-bromophenyl]cyclopropane-1-carbonitrile (PubChem CID 20616591) has the molecular formula C14H12BrN5O2 and a molecular weight of 362.19 g/mol. Its IUPAC name is 1-[4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-bromophenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-bromophenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 20616591 |
| Molecular Formula | C14H12BrN5O2 |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 1-[4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-bromophenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(N3C[C@H](CN=[N+]=[N-])OC3=O)cc2Br)CC1 |
| InChI | InChI=1S/C14H12BrN5O2/c15-12-5-9(1-2-11(12)14(8-16)3-4-14)20-7-10(6-18-19-17)22-13(20)21/h1-2,5,10H,3-4,6-7H2/t10-/m0/s1 |
| InChIKey | CTZLOWYLBZRXFJ-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 102.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|