C21H30N2O4S — CID 20630149
5-(tert-butylsulfonylamino)-N-[4-(furan-2-yl)-2,3-dimethylphenyl]pentanamide (PubChem CID 20630149) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-[4-(furan-2-yl)-2,3-dimethylphenyl]pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-[4-(furan-2-yl)-2,3-dimethylphenyl]pentanamide |
|---|---|
| PubChem CID | 20630149 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-[4-(furan-2-yl)-2,3-dimethylphenyl]pentanamide |
| SMILES | Cc1c(NC(=O)CCCCNS(=O)(=O)C(C)(C)C)ccc(-c2ccco2)c1C |
| InChI | InChI=1S/C21H30N2O4S/c1-15-16(2)18(12-11-17(15)19-9-8-14-27-19)23-20(24)10-6-7-13-22-28(25,26)21(3,4)5/h8-9,11-12,14,22H,6-7,10,13H2,1-5H3,(H,23,24) |
| InChIKey | FNAOPNBQVUMEHO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|