C19H28N2O5S — CID 20629546
5-(tert-butylsulfonylamino)-N-(2-hydroxy-5-methyl-2H-chromen-6-yl)pentanamide (PubChem CID 20629546) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-(2-hydroxy-5-methyl-2H-chromen-6-yl)pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-(2-hydroxy-5-methyl-2H-chromen-6-yl)pentanamide |
|---|---|
| PubChem CID | 20629546 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-(2-hydroxy-5-methyl-2H-chromen-6-yl)pentanamide |
| SMILES | Cc1c(NC(=O)CCCCNS(=O)(=O)C(C)(C)C)ccc2c1C=CC(O)O2 |
| InChI | InChI=1S/C19H28N2O5S/c1-13-14-8-11-18(23)26-16(14)10-9-15(13)21-17(22)7-5-6-12-20-27(24,25)19(2,3)4/h8-11,18,20,23H,5-7,12H2,1-4H3,(H,21,22) |
| InChIKey | SWVPGCZSLQNYHH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|