C20H34N2O2S — CID 70939743
N-[5-[(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 70939743) has the molecular formula C20H34N2O2S and a molecular weight of 366.57 g/mol. Its IUPAC name is N-[5-[(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[5-[(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70939743 |
| Molecular Formula | C20H34N2O2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[5-[(1,4-dimethyl-2,3-dihydro-1H-inden-5-yl)amino]pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | Cc1c(NCCCCCNS(=O)(=O)C(C)(C)C)ccc2c1CCC2C |
| InChI | InChI=1S/C20H34N2O2S/c1-15-9-10-18-16(2)19(12-11-17(15)18)21-13-7-6-8-14-22-25(23,24)20(3,4)5/h11-12,15,21-22H,6-10,13-14H2,1-5H3 |
| InChIKey | DUYIPHDNCONAAD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|