C21H35N3O4S — CID 20631001
2,3,5-trimethyl-N-propan-2-yl-4-[5-(propan-2-ylsulfonylamino)pentanoylamino]benzamide (PubChem CID 20631001) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is 2,3,5-trimethyl-N-propan-2-yl-4-[5-(propan-2-ylsulfonylamino)pentanoylamino]benzamide.
| Compound Name | 2,3,5-trimethyl-N-propan-2-yl-4-[5-(propan-2-ylsulfonylamino)pentanoylamino]benzamide |
|---|---|
| PubChem CID | 20631001 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2,3,5-trimethyl-N-propan-2-yl-4-[5-(propan-2-ylsulfonylamino)pentanoylamino]benzamide |
| SMILES | Cc1cc(C(=O)NC(C)C)c(C)c(C)c1NC(=O)CCCCNS(=O)(=O)C(C)C |
| InChI | InChI=1S/C21H35N3O4S/c1-13(2)23-21(26)18-12-15(5)20(17(7)16(18)6)24-19(25)10-8-9-11-22-29(27,28)14(3)4/h12-14,22H,8-11H2,1-7H3,(H,23,26)(H,24,25) |
| InChIKey | AAUPPHIXMPOFJV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|