C8H16BNO4 — CID 20648774
N-(1-methoxy-1-oxo-3-prop-2-enoxypropan-2-yl)-methylboronamidic acid (PubChem CID 20648774) has the molecular formula C8H16BNO4 and a molecular weight of 201.03 g/mol. Its IUPAC name is N-(1-methoxy-1-oxo-3-prop-2-enoxypropan-2-yl)-methylboronamidic acid.
| Compound Name | N-(1-methoxy-1-oxo-3-prop-2-enoxypropan-2-yl)-methylboronamidic acid |
|---|---|
| PubChem CID | 20648774 |
| Molecular Formula | C8H16BNO4 |
| Molecular Weight | 201.03 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-(1-methoxy-1-oxo-3-prop-2-enoxypropan-2-yl)-methylboronamidic acid |
| SMILES | C=CCOCC(NB(C)O)C(=O)OC |
| InChI | InChI=1S/C8H16BNO4/c1-4-5-14-6-7(8(11)13-3)10-9(2)12/h4,7,10,12H,1,5-6H2,2-3H3 |
| InChIKey | PGNSTHKGXRKBMP-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.03 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|