About iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid
iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid (PubChem CID 59437343) has the molecular formula C5H11BINO3Zn
and a molecular weight of 336.25 g/mol. Its IUPAC name is iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid.
Molecular Properties
| Compound Name | iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid |
| PubChem CID | 59437343 |
| Molecular Formula | C5H11BINO3Zn |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid |
| SMILES | [CH2-][C@@H](NB(C)O)C(=O)OC.[Zn+]I |
| InChI | InChI=1S/C5H11BNO3.HI.Zn/c1-4(5(8)10-3)7-6(2)9;;/h4,7,9H,1H2,2-3H3;1H;/q-1;;+2/p-1/t4-;;/m1../s1 |
| InChIKey | CNMXIVSHQVGLFD-RZFWHQLPSA-M |
| XLogP | -0.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid?
The IUPAC name of iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid (CID 59437343) is iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid.
What is the SMILES notation for iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid?
The canonical SMILES for iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid is [CH2-][C@@H](NB(C)O)C(=O)OC.[Zn+]I.
What is the InChIKey of iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid?
The InChIKey is CNMXIVSHQVGLFD-RZFWHQLPSA-M. The full InChI is InChI=1S/C5H11BNO3.HI.Zn/c1-4(5(8)10-3)7-6(2)9;;/h4,7,9H,1H2,2-3H3;1H;/q-1;;+2/p-1/t4-;;/m1../s1.
What are the key properties of iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid?
iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid has a molecular weight of 336.25 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iodozinc(1+);N-[(2R)-1-methoxy-1-oxopropan-2-yl]-methylboronamidic acid is sourced from PubChem (CID 59437343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).