C17H18N5S+ — CID 2065713
N-(3-benzyl-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium-6-yl)-1,3-benzothiazol-2-amine (PubChem CID 2065713) has the molecular formula C17H18N5S+ and a molecular weight of 324.43 g/mol. Its IUPAC name is N-(3-benzyl-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium-6-yl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(3-benzyl-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium-6-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 2065713 |
| Molecular Formula | C17H18N5S+ |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-(3-benzyl-1,2,3,4-tetrahydro-1,3,5-triazin-3-ium-6-yl)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc(C[NH+]2CN=C(Nc3nc4ccccc4s3)NC2)cc1 |
| InChI | InChI=1S/C17H17N5S/c1-2-6-13(7-3-1)10-22-11-18-16(19-12-22)21-17-20-14-8-4-5-9-15(14)23-17/h1-9H,10-12H2,(H2,18,19,20,21)/p+1 |
| InChIKey | KCXUCCDSPWSBOC-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 53.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |