C10H17N5O2 — CID 20668484
1,2,3-trimethyl-1-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]guanidine (PubChem CID 20668484) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 1,2,3-trimethyl-1-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]guanidine.
| Compound Name | 1,2,3-trimethyl-1-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 20668484 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1,2,3-trimethyl-1-[(5-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]guanidine |
| SMILES | C/N=C(\NC)N(C)Cc1[nH]c(=O)[nH]c(=O)c1C |
| InChI | InChI=1S/C10H17N5O2/c1-6-7(13-10(17)14-8(6)16)5-15(4)9(11-2)12-3/h5H2,1-4H3,(H,11,12)(H2,13,14,16,17) |
| InChIKey | BEDBZNOYJCTVAX-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|