C16H24O3 — CID 20668763
1',4',4'a,5'-tetramethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 20668763) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 1',4',4'a,5'-tetramethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | 1',4',4'a,5'-tetramethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 20668763 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1',4',4'a,5'-tetramethylspiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | CC1=C2CCC3(OCCO3)C(C)C2(C)C(C)CC1=O |
| InChI | InChI=1S/C16H24O3/c1-10-9-14(17)11(2)13-5-6-16(18-7-8-19-16)12(3)15(10,13)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | LKWPIGIRKYHRIJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |