C26H31F2N3O — CID 20677454
2-(3,4-difluorophenyl)-N-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-3-methylbutanamide (PubChem CID 20677454) has the molecular formula C26H31F2N3O and a molecular weight of 439.55 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-3-methylbutanamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 20677454 |
| Molecular Formula | C26H31F2N3O |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-3-methylbutanamide |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(CCCNC(=O)C(c2ccc(F)c(F)c2)C(C)C)CC1 |
| InChI | InChI=1S/C26H31F2N3O/c1-19(2)24(20-10-11-22(27)23(28)18-20)25(32)30-14-7-15-31-16-12-26(29-3,13-17-31)21-8-5-4-6-9-21/h4-6,8-11,18-19,24H,7,12-17H2,1-2H3,(H,30,32) |
| InChIKey | QVLIRIXZRUKHNW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|