C21H24N6O6 — CID 20685810
N-[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2,5-dimethoxyphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine (PubChem CID 20685810) has the molecular formula C21H24N6O6 and a molecular weight of 456.46 g/mol. Its IUPAC name is N-[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2,5-dimethoxyphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2,5-dimethoxyphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 20685810 |
| Molecular Formula | C21H24N6O6 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2,5-dimethoxyphenyl]-4,6-dimethyl-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2nc(C)nc(C)n2)c(OC)cc1/N=N/c1cc(COO)cc(COO)c1 |
| InChI | InChI=1S/C21H24N6O6/c1-12-22-13(2)24-21(23-12)25-17-8-20(31-4)18(9-19(17)30-3)27-26-16-6-14(10-32-28)5-15(7-16)11-33-29/h5-9,28-29H,10-11H2,1-4H3,(H,22,23,24,25)/b27-26+ |
| InChIKey | GHUXHUKDDGHDLW-CYYJNZCTSA-N |
| XLogP | 4.64 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|