C34H46 — CID 20692314
1-[bis(2,3,4,5,6-pentamethylphenyl)methyl]-2,3,4,5,6-pentamethylbenzene (PubChem CID 20692314) has the molecular formula C34H46 and a molecular weight of 454.74 g/mol. Its IUPAC name is 1-[bis(2,3,4,5,6-pentamethylphenyl)methyl]-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-[bis(2,3,4,5,6-pentamethylphenyl)methyl]-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 20692314 |
| Molecular Formula | C34H46 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | 1-[bis(2,3,4,5,6-pentamethylphenyl)methyl]-2,3,4,5,6-pentamethylbenzene |
| SMILES | Cc1c(C)c(C)c(C(c2c(C)c(C)c(C)c(C)c2C)c2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C34H46/c1-16-19(4)25(10)31(26(11)20(16)5)34(32-27(12)21(6)17(2)22(7)28(32)13)33-29(14)23(8)18(3)24(9)30(33)15/h34H,1-15H3 |
| InChIKey | QWPMBETVSVXOND-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|