C26H38O — CID 7038972
1,2,3,4,5-pentamethyl-6-[(1S)-1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]benzene (PubChem CID 7038972) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-[(1S)-1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-[(1S)-1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]benzene |
|---|---|
| PubChem CID | 7038972 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-[(1S)-1-[(1S)-1-(2,3,4,5,6-pentamethylphenyl)ethoxy]ethyl]benzene |
| SMILES | Cc1c(C)c(C)c([C@H](C)O[C@@H](C)c2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C26H38O/c1-13-15(3)19(7)25(20(8)16(13)4)23(11)27-24(12)26-21(9)17(5)14(2)18(6)22(26)10/h23-24H,1-12H3/t23-,24-/m0/s1 |
| InChIKey | HJPUYZSEGWLQKH-ZEQRLZLVSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |