C13H10F5N5O5S — CID 20707032
[[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino] 2-(trifluoromethoxy)benzenesulfinate (PubChem CID 20707032) has the molecular formula C13H10F5N5O5S and a molecular weight of 443.31 g/mol. Its IUPAC name is [[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino] 2-(trifluoromethoxy)benzenesulfinate.
| Compound Name | [[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino] 2-(trifluoromethoxy)benzenesulfinate |
|---|---|
| PubChem CID | 20707032 |
| Molecular Formula | C13H10F5N5O5S |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | [[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino] 2-(trifluoromethoxy)benzenesulfinate |
| SMILES | COc1nc(NC(=O)NOS(=O)c2ccccc2OC(F)(F)F)nc(C(F)F)n1 |
| InChI | InChI=1S/C13H10F5N5O5S/c1-26-12-20-9(8(14)15)19-10(22-12)21-11(24)23-28-29(25)7-5-3-2-4-6(7)27-13(16,17)18/h2-5,8H,1H3,(H2,19,20,21,22,23,24) |
| InChIKey | KLJHOFYWTTXCPI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|