C13H13F2N5O7S2 — CID 20707031
[2-[[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino]oxysulfinylphenyl] methanesulfonate (PubChem CID 20707031) has the molecular formula C13H13F2N5O7S2 and a molecular weight of 453.41 g/mol. Its IUPAC name is [2-[[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino]oxysulfinylphenyl] methanesulfonate.
| Compound Name | [2-[[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino]oxysulfinylphenyl] methanesulfonate |
|---|---|
| PubChem CID | 20707031 |
| Molecular Formula | C13H13F2N5O7S2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | [2-[[4-(difluoromethyl)-6-methoxy-1,3,5-triazin-2-yl]carbamoylamino]oxysulfinylphenyl] methanesulfonate |
| SMILES | COc1nc(NC(=O)NOS(=O)c2ccccc2OS(C)(=O)=O)nc(C(F)F)n1 |
| InChI | InChI=1S/C13H13F2N5O7S2/c1-25-13-17-10(9(14)15)16-11(19-13)18-12(21)20-27-28(22)8-6-4-3-5-7(8)26-29(2,23)24/h3-6,9H,1-2H3,(H2,16,17,18,19,20,21) |
| InChIKey | MNWYOTNCORXQNO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|