C15H20N6O7S — CID 175236571
3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-(2-methoxyethoxysulfamoyl)-1-phenylurea (PubChem CID 175236571) has the molecular formula C15H20N6O7S and a molecular weight of 428.43 g/mol. Its IUPAC name is 3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-(2-methoxyethoxysulfamoyl)-1-phenylurea.
| Compound Name | 3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-(2-methoxyethoxysulfamoyl)-1-phenylurea |
|---|---|
| PubChem CID | 175236571 |
| Molecular Formula | C15H20N6O7S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-1-(2-methoxyethoxysulfamoyl)-1-phenylurea |
| SMILES | COCCONS(=O)(=O)N(C(=O)Nc1nc(OC)nc(OC)n1)c1ccccc1 |
| InChI | InChI=1S/C15H20N6O7S/c1-25-9-10-28-20-29(23,24)21(11-7-5-4-6-8-11)15(22)18-12-16-13(26-2)19-14(17-12)27-3/h4-8,20H,9-10H2,1-3H3,(H,16,17,18,19,22) |
| InChIKey | FJHQVVNSWVLULD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|