C17H21N5O7S — CID 54471108
2-ethoxyethyl N-(benzenesulfonyl)-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]carbamate (PubChem CID 54471108) has the molecular formula C17H21N5O7S and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-ethoxyethyl N-(benzenesulfonyl)-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]carbamate.
| Compound Name | 2-ethoxyethyl N-(benzenesulfonyl)-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 54471108 |
| Molecular Formula | C17H21N5O7S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-ethoxyethyl N-(benzenesulfonyl)-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]carbamate |
| SMILES | CCOCCOC(=O)N(C(=O)Nc1nc(C)nc(OC)n1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21N5O7S/c1-4-28-10-11-29-17(24)22(30(25,26)13-8-6-5-7-9-13)16(23)21-14-18-12(2)19-15(20-14)27-3/h5-9H,4,10-11H2,1-3H3,(H,18,19,20,21,23) |
| InChIKey | XIKWXRRNTVFNPR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|