C17H20N6O5S — CID 19695695
1-[2-(3-ethoxyprop-1-ynyl)phenyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-1-sulfamoylurea (PubChem CID 19695695) has the molecular formula C17H20N6O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is 1-[2-(3-ethoxyprop-1-ynyl)phenyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-1-sulfamoylurea.
| Compound Name | 1-[2-(3-ethoxyprop-1-ynyl)phenyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-1-sulfamoylurea |
|---|---|
| PubChem CID | 19695695 |
| Molecular Formula | C17H20N6O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-[2-(3-ethoxyprop-1-ynyl)phenyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-1-sulfamoylurea |
| SMILES | CCOCC#Cc1ccccc1N(C(=O)Nc1nc(C)nc(OC)n1)S(N)(=O)=O |
| InChI | InChI=1S/C17H20N6O5S/c1-4-28-11-7-9-13-8-5-6-10-14(13)23(29(18,25)26)17(24)22-15-19-12(2)20-16(21-15)27-3/h5-6,8,10H,4,11H2,1-3H3,(H2,18,25,26)(H,19,20,21,22,24) |
| InChIKey | ATGIPTWXBOCIFC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|