C22H22N4O5 — CID 20708466
phenyl N-cyano-N'-[(2S,3S,4R)-6-cyano-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]carbamimidate (PubChem CID 20708466) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is phenyl N-cyano-N'-[(2S,3S,4R)-6-cyano-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]carbamimidate.
| Compound Name | phenyl N-cyano-N'-[(2S,3S,4R)-6-cyano-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]carbamimidate |
|---|---|
| PubChem CID | 20708466 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | phenyl N-cyano-N'-[(2S,3S,4R)-6-cyano-2-(dimethoxymethyl)-3-hydroxy-2-methyl-3,4-dihydrochromen-4-yl]carbamimidate |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc(C#N)cc2[C@@H](/N=C(/NC#N)Oc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C22H22N4O5/c1-22(20(28-2)29-3)19(27)18(16-11-14(12-23)9-10-17(16)31-22)26-21(25-13-24)30-15-7-5-4-6-8-15/h4-11,18-20,27H,1-3H3,(H,25,26)/t18-,19+,22+/m1/s1 |
| InChIKey | VQAKHXUUENCXPV-DXIQSLLYSA-N |
| XLogP | 2.24 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|