C22H22F3N5O6 — CID 46916693
1-cyano-2-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 46916693) has the molecular formula C22H22F3N5O6 and a molecular weight of 509.44 g/mol. Its IUPAC name is 1-cyano-2-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-cyano-2-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 46916693 |
| Molecular Formula | C22H22F3N5O6 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 1-cyano-2-[(2R,3R,4S)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-3-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | COC(OC)[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](/N=C(\NC#N)Nc2cccc(C(F)(F)F)c2)[C@H]1O |
| InChI | InChI=1S/C22H22F3N5O6/c1-21(19(34-2)35-3)18(31)17(15-10-14(30(32)33)7-8-16(15)36-21)29-20(27-11-26)28-13-6-4-5-12(9-13)22(23,24)25/h4-10,17-19,31H,1-3H3,(H2,27,28,29)/t17-,18+,21+/m0/s1 |
| InChIKey | WLKBEKAZZHSQMF-WAOWUJCRSA-N |
| XLogP | 3.32 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|