C14H16F9NO — CID 20727673
2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azepan-1-yl]prop-2-en-1-one (PubChem CID 20727673) has the molecular formula C14H16F9NO and a molecular weight of 385.27 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azepan-1-yl]prop-2-en-1-one.
| Compound Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 20727673 |
| Molecular Formula | C14H16F9NO |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-methyl-1-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azepan-1-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CCCCCC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F9NO/c1-8(2)10(25)24-7-5-3-4-6-9(24)11(15,16)12(17,18)13(19,20)14(21,22)23/h9H,1,3-7H2,2H3 |
| InChIKey | ATKQBJQSCMNPTH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|