About CID 20745087
CID 20745087 (PubChem CID 20745087) has the molecular formula C5H11GeY
and a molecular weight of 232.66 g/mol.
Molecular Properties
| Compound Name | CID 20745087 |
| PubChem CID | 20745087 |
| Molecular Formula | C5H11GeY |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 233.91 |
| IUPAC Name | — |
| SMILES | C=C(C)[Ge](C)C.[Y] |
| InChI | InChI=1S/C5H11Ge.Y/c1-5(2)6(3)4;/h1H2,2-4H3; |
| InChIKey | BTJBXFBSLGNKJJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 20745087 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20745087?
The IUPAC name of CID 20745087 (CID 20745087) is not available.
What is the SMILES notation for CID 20745087?
The canonical SMILES for CID 20745087 is C=C(C)[Ge](C)C.[Y].
What is the InChIKey of CID 20745087?
The InChIKey is BTJBXFBSLGNKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Ge.Y/c1-5(2)6(3)4;/h1H2,2-4H3;.
What are the key properties of CID 20745087?
CID 20745087 has a molecular weight of 232.66 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20745087 is sourced from PubChem (CID 20745087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).