C15H30N3O14P — CID 20762864
4-hydroxy-N-[2-[6-(methylamino)hexanoylamino]ethyl]-5-(phosphanylperoxyperoxyperoxyperoxyperoxymethyl)oxolane-2-carboxamide (PubChem CID 20762864) has the molecular formula C15H30N3O14P and a molecular weight of 507.39 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[6-(methylamino)hexanoylamino]ethyl]-5-(phosphanylperoxyperoxyperoxyperoxyperoxymethyl)oxolane-2-carboxamide.
| Compound Name | 4-hydroxy-N-[2-[6-(methylamino)hexanoylamino]ethyl]-5-(phosphanylperoxyperoxyperoxyperoxyperoxymethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 20762864 |
| Molecular Formula | C15H30N3O14P |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-hydroxy-N-[2-[6-(methylamino)hexanoylamino]ethyl]-5-(phosphanylperoxyperoxyperoxyperoxyperoxymethyl)oxolane-2-carboxamide |
| SMILES | CNCCCCCC(=O)NCCNC(=O)C1CC(O)C(COOOOOOOOOOP)O1 |
| InChI | InChI=1S/C15H30N3O14P/c1-16-6-4-2-3-5-14(20)17-7-8-18-15(21)12-9-11(19)13(23-12)10-22-24-25-26-27-28-29-30-31-32-33/h11-13,16,19H,2-10,33H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | PGGZMQGJTONCGH-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 191.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|