C16H21NO3 — CID 20765102
7-benzyliminohept-1-en-3-yl methyl carbonate (PubChem CID 20765102) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 7-benzyliminohept-1-en-3-yl methyl carbonate.
| Compound Name | 7-benzyliminohept-1-en-3-yl methyl carbonate |
|---|---|
| PubChem CID | 20765102 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 7-benzyliminohept-1-en-3-yl methyl carbonate |
| SMILES | C=CC(CCC/C=N/Cc1ccccc1)OC(=O)OC |
| InChI | InChI=1S/C16H21NO3/c1-3-15(20-16(18)19-2)11-7-8-12-17-13-14-9-5-4-6-10-14/h3-6,9-10,12,15H,1,7-8,11,13H2,2H3/b17-12+ |
| InChIKey | MRZCGIJEWMIQAN-SFQUDFHCSA-N |
| XLogP | 3.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|