C17H25NO3S — CID 20766379
N-(benzenesulfonyl)-2-[1-(2-methylpropyl)cyclopentyl]acetamide (PubChem CID 20766379) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[1-(2-methylpropyl)cyclopentyl]acetamide.
| Compound Name | N-(benzenesulfonyl)-2-[1-(2-methylpropyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 20766379 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(benzenesulfonyl)-2-[1-(2-methylpropyl)cyclopentyl]acetamide |
| SMILES | CC(C)CC1(CC(=O)NS(=O)(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H25NO3S/c1-14(2)12-17(10-6-7-11-17)13-16(19)18-22(20,21)15-8-4-3-5-9-15/h3-5,8-9,14H,6-7,10-13H2,1-2H3,(H,18,19) |
| InChIKey | ZROPZWCOKSHANQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |