C14H8F7N2O+ — CID 20784017
10-(2,2,3,3,4,4,4-heptafluorobutyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one (PubChem CID 20784017) has the molecular formula C14H8F7N2O+ and a molecular weight of 353.22 g/mol. Its IUPAC name is 10-(2,2,3,3,4,4,4-heptafluorobutyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one.
| Compound Name | 10-(2,2,3,3,4,4,4-heptafluorobutyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
|---|---|
| PubChem CID | 20784017 |
| Molecular Formula | C14H8F7N2O+ |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 10-(2,2,3,3,4,4,4-heptafluorobutyl)-1-aza-10-azoniatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-11-one |
| SMILES | O=c1n2ccc3cccc(c[n+]1CC(F)(F)C(F)(F)C(F)(F)F)c32 |
| InChI | InChI=1S/C14H8F7N2O/c15-12(16,13(17,18)14(19,20)21)7-22-6-9-3-1-2-8-4-5-23(10(8)9)11(22)24/h1-6H,7H2/q+1 |
| InChIKey | CVNKDYHKTNAJID-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|