C19H22N2O+2 — CID 20806994
3-benzyl-4,5-dimethyl-1-phenylmethoxy-1H-imidazole-1,3-diium (PubChem CID 20806994) has the molecular formula C19H22N2O+2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-benzyl-4,5-dimethyl-1-phenylmethoxy-1H-imidazole-1,3-diium.
| Compound Name | 3-benzyl-4,5-dimethyl-1-phenylmethoxy-1H-imidazole-1,3-diium |
|---|---|
| PubChem CID | 20806994 |
| Molecular Formula | C19H22N2O+2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-benzyl-4,5-dimethyl-1-phenylmethoxy-1H-imidazole-1,3-diium |
| SMILES | CC1=C(C)[NH+](OCc2ccccc2)C=[N+]1Cc1ccccc1 |
| InChI | InChI=1S/C19H21N2O/c1-16-17(2)21(22-14-19-11-7-4-8-12-19)15-20(16)13-18-9-5-3-6-10-18/h3-12,15H,13-14H2,1-2H3/q+1/p+1 |
| InChIKey | STNOMJIIWKPCSB-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 16.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|